C24H35NO5S — CID 52946861
(4R)-3-ethyl-4-[(1R,4Z,8E,10Z,12S,15R,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one (PubChem CID 52946861) has the molecular formula C24H35NO5S and a molecular weight of 449.61 g/mol. Its IUPAC name is (4R)-3-ethyl-4-[(1R,4Z,8E,10Z,12S,15R,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-3-ethyl-4-[(1R,4Z,8E,10Z,12S,15R,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 52946861 |
| Molecular Formula | C24H35NO5S |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (4R)-3-ethyl-4-[(1R,4Z,8E,10Z,12S,15R,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one |
| SMILES | CCN1C(=O)SC[C@H]1[C@@]1(O)C[C@H]2C[C@@H](CC[C@H](C)/C=C\C=C\CC/C(C)=C\C(=O)O2)O1 |
| InChI | InChI=1S/C24H35NO5S/c1-4-25-21(16-31-23(25)27)24(28)15-20-14-19(30-24)12-11-17(2)9-7-5-6-8-10-18(3)13-22(26)29-20/h5-7,9,13,17,19-21,28H,4,8,10-12,14-16H2,1-3H3/b6-5+,9-7-,18-13-/t17-,19-,20-,21+,24-/m1/s1 |
| InChIKey | UHBLVXMFQQHCOH-OEHJBKSGSA-N |
| XLogP | 4.59 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|