C19H18N2O4S — CID 52946865
[5-amino-2-(1,3-thiazol-2-yl)phenyl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 52946865) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is [5-amino-2-(1,3-thiazol-2-yl)phenyl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [5-amino-2-(1,3-thiazol-2-yl)phenyl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 52946865 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [5-amino-2-(1,3-thiazol-2-yl)phenyl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cc(N)ccc2-c2nccs2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18N2O4S/c1-23-15-8-11(9-16(24-2)18(15)25-3)17(22)14-10-12(20)4-5-13(14)19-21-6-7-26-19/h4-10H,20H2,1-3H3 |
| InChIKey | GFVCSBBZUFSRFF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|