C26H29N7O2 — CID 52946955
2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indol-4-yl)pyrimidine-2,4-diamine (PubChem CID 52946955) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 52946955 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-N-(3,5-dimorpholin-4-ylphenyl)-4-N-(1H-indol-4-yl)pyrimidine-2,4-diamine |
| SMILES | c1cc(Nc2ccnc(Nc3cc(N4CCOCC4)cc(N4CCOCC4)c3)n2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C26H29N7O2/c1-2-23-22(4-6-27-23)24(3-1)30-25-5-7-28-26(31-25)29-19-16-20(32-8-12-34-13-9-32)18-21(17-19)33-10-14-35-15-11-33/h1-7,16-18,27H,8-15H2,(H2,28,29,30,31) |
| InChIKey | WZSPEUXTQGLMHA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |