C19H15Cl2N3O2 — CID 52947148
1-(3-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-oxo-3-pyridinyl]urea (PubChem CID 52947148) has the molecular formula C19H15Cl2N3O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-oxo-3-pyridinyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-oxo-3-pyridinyl]urea |
|---|---|
| PubChem CID | 52947148 |
| Molecular Formula | C19H15Cl2N3O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[1-[(2-chlorophenyl)methyl]-2-oxo-3-pyridinyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1cccn(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C19H15Cl2N3O2/c20-14-6-3-7-15(11-14)22-19(26)23-17-9-4-10-24(18(17)25)12-13-5-1-2-8-16(13)21/h1-11H,12H2,(H2,22,23,26) |
| InChIKey | XCIOYIKQWJXFSP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |