C15H17ClN2O3 — CID 52947278
(2R,3R,4S)-1-[(2-chloroquinolin-8-yl)methyl]-2-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 52947278) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is (2R,3R,4S)-1-[(2-chloroquinolin-8-yl)methyl]-2-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4S)-1-[(2-chloroquinolin-8-yl)methyl]-2-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 52947278 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (2R,3R,4S)-1-[(2-chloroquinolin-8-yl)methyl]-2-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | OC[C@@H]1[C@@H](O)[C@@H](O)CN1Cc1cccc2ccc(Cl)nc12 |
| InChI | InChI=1S/C15H17ClN2O3/c16-13-5-4-9-2-1-3-10(14(9)17-13)6-18-7-12(20)15(21)11(18)8-19/h1-5,11-12,15,19-21H,6-8H2/t11-,12+,15-/m1/s1 |
| InChIKey | XHLZIDPVPGGMQE-TYNCELHUSA-N |
| XLogP | 0.79 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|