C22H19ClN4O — CID 52947297
4-(5-chloro-2-pyridinyl)-1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)pyridin-2-one (PubChem CID 52947297) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)pyridin-2-one.
| Compound Name | 4-(5-chloro-2-pyridinyl)-1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)pyridin-2-one |
|---|---|
| PubChem CID | 52947297 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-1-(9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indol-7-yl)pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(-c5ccc(Cl)cn5)cc4=O)cc31)CCNC2 |
| InChI | InChI=1S/C22H19ClN4O/c1-26-20-11-16(3-4-17(20)18-6-8-24-13-21(18)26)27-9-7-14(10-22(27)28)19-5-2-15(23)12-25-19/h2-5,7,9-12,24H,6,8,13H2,1H3 |
| InChIKey | OWNIXUOKCZCOOZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|