C22H19N3O5 — CID 52947338
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione (PubChem CID 52947338) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52947338 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(4-methoxyphenyl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C#C[C@]2(CN3Cc4ccc(OC)cc4C3=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C22H19N3O5/c1-29-16-6-3-14(4-7-16)9-10-22(20(27)23-21(28)24-22)13-25-12-15-5-8-17(30-2)11-18(15)19(25)26/h3-8,11H,12-13H2,1-2H3,(H2,23,24,27,28)/t22-/m1/s1 |
| InChIKey | VRGMRKNAXIYVGL-JOCHJYFZSA-N |
| XLogP | 1.29 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|