C17H16FN3O3S — CID 52947390
6-[(1,1-dioxothiolan-3-yl)methylamino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 52947390) has the molecular formula C17H16FN3O3S and a molecular weight of 361.40 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-3-yl)methylamino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-[(1,1-dioxothiolan-3-yl)methylamino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 52947390 |
| Molecular Formula | C17H16FN3O3S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 6-[(1,1-dioxothiolan-3-yl)methylamino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2nc(NCC3CCS(=O)(=O)C3)c3ccc(F)cc3c12 |
| InChI | InChI=1S/C17H16FN3O3S/c18-11-1-2-12-13(7-11)15-14(3-5-19-17(15)22)21-16(12)20-8-10-4-6-25(23,24)9-10/h1-3,5,7,10H,4,6,8-9H2,(H,19,22)(H,20,21) |
| InChIKey | YJQUADKQWWERLA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|