C22H17N5O4 — CID 52947420
(5R)-5-[2-(3H-benzimidazol-5-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 52947420) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is (5R)-5-[2-(3H-benzimidazol-5-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-(3H-benzimidazol-5-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52947420 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (5R)-5-[2-(3H-benzimidazol-5-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc4nc[nH]c4c3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C22H17N5O4/c1-31-15-4-3-14-10-27(19(28)16(14)9-15)11-22(20(29)25-21(30)26-22)7-6-13-2-5-17-18(8-13)24-12-23-17/h2-5,8-9,12H,10-11H2,1H3,(H,23,24)(H2,25,26,29,30)/t22-/m1/s1 |
| InChIKey | RYWQUAWGPJFTEM-JOCHJYFZSA-N |
| XLogP | 1.16 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|