About CID 52947614
CID 52947614 (PubChem CID 52947614) has the molecular formula C30H29ClN2O6
and a molecular weight of 549.02 g/mol.
Molecular Properties
| Compound Name | CID 52947614 |
| PubChem CID | 52947614 |
| Molecular Formula | C30H29ClN2O6 |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2CN(C)C3(C(=O)Nc4ccc(Cl)cc43)C23Cc2cc(OC)c(OC)cc2C3=O)cc1OC |
| InChI | InChI=1S/C30H29ClN2O6/c1-33-15-21(16-6-9-23(36-2)24(10-16)37-3)29(30(33)20-12-18(31)7-8-22(20)32-28(30)35)14-17-11-25(38-4)26(39-5)13-19(17)27(29)34/h6-13,21H,14-15H2,1-5H3,(H,32,35) |
| InChIKey | WGXWWYALJTUFQJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 52947614 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 52947614?
The IUPAC name of CID 52947614 (CID 52947614) is not available.
What is the SMILES notation for CID 52947614?
The canonical SMILES for CID 52947614 is COc1ccc(C2CN(C)C3(C(=O)Nc4ccc(Cl)cc43)C23Cc2cc(OC)c(OC)cc2C3=O)cc1OC.
What is the InChIKey of CID 52947614?
The InChIKey is WGXWWYALJTUFQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H29ClN2O6/c1-33-15-21(16-6-9-23(36-2)24(10-16)37-3)29(30(33)20-12-18(31)7-8-22(20)32-28(30)35)14-17-11-25(38-4)26(39-5)13-19(17)27(29)34/h6-13,21H,14-15H2,1-5H3,(H,32,35).
What are the key properties of CID 52947614?
CID 52947614 has a molecular weight of 549.02 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 52947614 is sourced from PubChem (CID 52947614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).