About 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride
8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride (PubChem CID 52947681) has the molecular formula C10H14ClN5
and a molecular weight of 239.71 g/mol. Its IUPAC name is 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride.
Molecular Properties
| Compound Name | 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride |
| PubChem CID | 52947681 |
| Molecular Formula | C10H14ClN5 |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride |
| SMILES | Cl.c1cn2ccnc2c(N2CCNCC2)n1 |
| InChI | InChI=1S/C10H13N5.ClH/c1-5-14(6-2-11-1)9-10-13-4-8-15(10)7-3-12-9;/h3-4,7-8,11H,1-2,5-6H2;1H |
| InChIKey | AEQRQFCNXWWLCE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride?
The IUPAC name of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride (CID 52947681) is 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride.
What is the SMILES notation for 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride?
The canonical SMILES for 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride is Cl.c1cn2ccnc2c(N2CCNCC2)n1.
What is the InChIKey of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride?
The InChIKey is AEQRQFCNXWWLCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5.ClH/c1-5-14(6-2-11-1)9-10-13-4-8-15(10)7-3-12-9;/h3-4,7-8,11H,1-2,5-6H2;1H.
What are the key properties of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride?
8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride has a molecular weight of 239.71 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrochloride is sourced from PubChem (CID 52947681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).