C24H30N2O2 — CID 52947719
N-ethyl-2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-phenylacetamide (PubChem CID 52947719) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-ethyl-2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-phenylacetamide.
| Compound Name | N-ethyl-2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 52947719 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-ethyl-2-[(1R,9R,12R)-4-hydroxy-1,12-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-phenylacetamide |
| SMILES | CCN(C(=O)CN1C[C@H](C)[C@@]2(C)C[C@H]1Cc1ccc(O)cc12)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O2/c1-4-26(19-8-6-5-7-9-19)23(28)16-25-15-17(2)24(3)14-20(25)12-18-10-11-21(27)13-22(18)24/h5-11,13,17,20,27H,4,12,14-16H2,1-3H3/t17-,20+,24+/m0/s1 |
| InChIKey | OQTGVOPTUXMAMC-WPSZSDGUSA-N |
| XLogP | 3.97 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |