C25H16FN5OS — CID 52947745
11-benzyl-13-(4-fluorophenyl)-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one (PubChem CID 52947745) has the molecular formula C25H16FN5OS and a molecular weight of 453.50 g/mol. Its IUPAC name is 11-benzyl-13-(4-fluorophenyl)-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one.
| Compound Name | 11-benzyl-13-(4-fluorophenyl)-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 52947745 |
| Molecular Formula | C25H16FN5OS |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 11-benzyl-13-(4-fluorophenyl)-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one |
| SMILES | O=c1c2ncn3nc(-c4ccsc4)cc3c2c(-c2ccc(F)cc2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C25H16FN5OS/c26-19-8-6-17(7-9-19)23-22-21-12-20(18-10-11-33-14-18)28-31(21)15-27-24(22)25(32)30(29-23)13-16-4-2-1-3-5-16/h1-12,14-15H,13H2 |
| InChIKey | FBVYCPXIPNHFHO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |