C24H35ClN4O4 — CID 52947817
propyl 2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride (PubChem CID 52947817) has the molecular formula C24H35ClN4O4 and a molecular weight of 479.02 g/mol. Its IUPAC name is propyl 2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride.
| Compound Name | propyl 2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 52947817 |
| Molecular Formula | C24H35ClN4O4 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | propyl 2-[4-[4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride |
| SMILES | CCCOC(=O)c1ccccc1N1CCN(CCCCN2C(=O)C3CCCN3C2=O)CC1.Cl |
| InChI | InChI=1S/C24H34N4O4.ClH/c1-2-18-32-23(30)19-8-3-4-9-20(19)26-16-14-25(15-17-26)11-5-6-12-28-22(29)21-10-7-13-27(21)24(28)31;/h3-4,8-9,21H,2,5-7,10-18H2,1H3;1H |
| InChIKey | GEGIILNWVXFCFV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|