C22H33N5O6 — CID 52948226
methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[(2-pyridin-3-ylacetyl)amino]hexanoyl]amino]propanoate (PubChem CID 52948226) has the molecular formula C22H33N5O6 and a molecular weight of 463.54 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[(2-pyridin-3-ylacetyl)amino]hexanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[(2-pyridin-3-ylacetyl)amino]hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 52948226 |
| Molecular Formula | C22H33N5O6 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-[(2-pyridin-3-ylacetyl)amino]hexanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](CCCCNC(=O)Cc1cccnc1)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C22H33N5O6/c1-14(25-16(3)28)20(30)27-18(21(31)26-15(2)22(32)33-4)9-5-6-11-24-19(29)12-17-8-7-10-23-13-17/h7-8,10,13-15,18H,5-6,9,11-12H2,1-4H3,(H,24,29)(H,25,28)(H,26,31)(H,27,30)/t14-,15-,18-/m0/s1 |
| InChIKey | XTLPPPBSZIQBEH-MPGHIAIKSA-N |
| XLogP | -0.40 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|