C21H11N3O3 — CID 52948328
5-methyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 52948328) has the molecular formula C21H11N3O3 and a molecular weight of 353.34 g/mol. Its IUPAC name is 5-methyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 5-methyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 52948328 |
| Molecular Formula | C21H11N3O3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 5-methyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | Cc1cccc2c1nc1c3ccc4c5c(ccc(c(=O)n21)c53)C(=O)NC4=O |
| InChI | InChI=1S/C21H11N3O3/c1-9-3-2-4-14-17(9)22-18-10-5-6-11-16-12(20(26)23-19(11)25)7-8-13(15(10)16)21(27)24(14)18/h2-8H,1H3,(H,23,25,26) |
| InChIKey | PHLZVDRNWYEEKR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|