About 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid
2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid (PubChem CID 52948356) has the molecular formula C15H19FO3
and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid |
| PubChem CID | 52948356 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(C[C@H]2CCC[C@@H]2O)cc1F |
| InChI | InChI=1S/C15H19FO3/c1-9(15(18)19)12-6-5-10(8-13(12)16)7-11-3-2-4-14(11)17/h5-6,8-9,11,14,17H,2-4,7H2,1H3,(H,18,19)/t9?,11-,14+/m1/s1 |
| InChIKey | SNSNKHOGRIQHBJ-VBIMLKNSSA-N |
| XLogP | 2.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid?
The IUPAC name of 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid (CID 52948356) is 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid.
What is the SMILES notation for 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid?
The canonical SMILES for 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid is CC(C(=O)O)c1ccc(C[C@H]2CCC[C@@H]2O)cc1F.
What is the InChIKey of 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid?
The InChIKey is SNSNKHOGRIQHBJ-VBIMLKNSSA-N. The full InChI is InChI=1S/C15H19FO3/c1-9(15(18)19)12-6-5-10(8-13(12)16)7-11-3-2-4-14(11)17/h5-6,8-9,11,14,17H,2-4,7H2,1H3,(H,18,19)/t9?,11-,14+/m1/s1.
What are the key properties of 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid?
2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid has a molecular weight of 266.31 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-fluoro-4-[[(1R,2S)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid is sourced from PubChem (CID 52948356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).