C30H44N2O5 — CID 52948369
N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methoxy-6-(3-pyridin-3-ylpropoxy)benzamide (PubChem CID 52948369) has the molecular formula C30H44N2O5 and a molecular weight of 512.69 g/mol. Its IUPAC name is N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methoxy-6-(3-pyridin-3-ylpropoxy)benzamide.
| Compound Name | N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methoxy-6-(3-pyridin-3-ylpropoxy)benzamide |
|---|---|
| PubChem CID | 52948369 |
| Molecular Formula | C30H44N2O5 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-2-methoxy-6-(3-pyridin-3-ylpropoxy)benzamide |
| SMILES | COc1cccc(OCCCc2cccnc2)c1C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C30H44N2O5/c1-21(2)18-25(33)29(34)24(19-22-10-5-4-6-11-22)32-30(35)28-26(36-3)14-7-15-27(28)37-17-9-13-23-12-8-16-31-20-23/h7-8,12,14-16,20-22,24-25,29,33-34H,4-6,9-11,13,17-19H2,1-3H3,(H,32,35)/t24-,25-,29+/m0/s1 |
| InChIKey | PJZBKGNAKHKHSH-IALVYGIMSA-N |
| XLogP | 4.94 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|