About 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde
3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde (PubChem CID 529484) has the molecular formula C6H6O4
and a molecular weight of 142.11 g/mol. Its IUPAC name is 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde.
Molecular Properties
| Compound Name | 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde |
| PubChem CID | 529484 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde |
| SMILES | O=CC1=CC(=O)C(O)CO1 |
| InChI | InChI=1S/C6H6O4/c7-2-4-1-5(8)6(9)3-10-4/h1-2,6,9H,3H2 |
| InChIKey | MOGMYZWZFVCQNF-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde?
The IUPAC name of 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde (CID 529484) is 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde.
What is the SMILES notation for 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde?
The canonical SMILES for 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde is O=CC1=CC(=O)C(O)CO1.
What is the InChIKey of 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde?
The InChIKey is MOGMYZWZFVCQNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4/c7-2-4-1-5(8)6(9)3-10-4/h1-2,6,9H,3H2.
What are the key properties of 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde?
3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde has a molecular weight of 142.11 g/mol, XLogP of -0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-oxo-2,3-dihydropyran-6-carbaldehyde is sourced from PubChem (CID 529484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).