C10H18N2O6S — CID 52948505
(5S)-1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-5-methoxyimidazolidine-2-thione (PubChem CID 52948505) has the molecular formula C10H18N2O6S and a molecular weight of 294.33 g/mol. Its IUPAC name is (5S)-1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-5-methoxyimidazolidine-2-thione.
| Compound Name | (5S)-1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-5-methoxyimidazolidine-2-thione |
|---|---|
| PubChem CID | 52948505 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (5S)-1-[(2R,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-5-methoxyimidazolidine-2-thione |
| SMILES | CO[C@H]1CNC(=S)N1[C@@H]1O[C@@H]([C@H](O)CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18N2O6S/c1-17-5-2-11-10(19)12(5)9-7(16)6(15)8(18-9)4(14)3-13/h4-9,13-16H,2-3H2,1H3,(H,11,19)/t4-,5+,6-,7-,8+,9-/m1/s1 |
| InChIKey | JROYFDJBTBTXQV-ZYWBIDCJSA-N |
| XLogP | -3.05 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|