About CID 52948540
CID 52948540 (PubChem CID 52948540) has the molecular formula C33H27ClN2O4
and a molecular weight of 551.04 g/mol.
Molecular Properties
| Compound Name | CID 52948540 |
| PubChem CID | 52948540 |
| Molecular Formula | C33H27ClN2O4 |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1OC)C(=O)C1(C2)C(c2ccccc2)C(c2ccccc2)NC12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C33H27ClN2O4/c1-39-26-15-21-18-32(30(37)23(21)17-27(26)40-2)28(19-9-5-3-6-10-19)29(20-11-7-4-8-12-20)36-33(32)24-16-22(34)13-14-25(24)35-31(33)38/h3-17,28-29,36H,18H2,1-2H3,(H,35,38) |
| InChIKey | GYHHALPUXKNWQM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 52948540 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 52948540?
The IUPAC name of CID 52948540 (CID 52948540) is not available.
What is the SMILES notation for CID 52948540?
The canonical SMILES for CID 52948540 is COc1cc2c(cc1OC)C(=O)C1(C2)C(c2ccccc2)C(c2ccccc2)NC12C(=O)Nc1ccc(Cl)cc12.
What is the InChIKey of CID 52948540?
The InChIKey is GYHHALPUXKNWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H27ClN2O4/c1-39-26-15-21-18-32(30(37)23(21)17-27(26)40-2)28(19-9-5-3-6-10-19)29(20-11-7-4-8-12-20)36-33(32)24-16-22(34)13-14-25(24)35-31(33)38/h3-17,28-29,36H,18H2,1-2H3,(H,35,38).
What are the key properties of CID 52948540?
CID 52948540 has a molecular weight of 551.04 g/mol, XLogP of 6.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 52948540 is sourced from PubChem (CID 52948540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).