C17H16F2N6O — CID 52948550
[5-amino-3-[4-(dimethylamino)anilino]-1,2,4-triazol-1-yl]-(2,6-difluorophenyl)methanone (PubChem CID 52948550) has the molecular formula C17H16F2N6O and a molecular weight of 358.35 g/mol. Its IUPAC name is [5-amino-3-[4-(dimethylamino)anilino]-1,2,4-triazol-1-yl]-(2,6-difluorophenyl)methanone.
| Compound Name | [5-amino-3-[4-(dimethylamino)anilino]-1,2,4-triazol-1-yl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 52948550 |
| Molecular Formula | C17H16F2N6O |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [5-amino-3-[4-(dimethylamino)anilino]-1,2,4-triazol-1-yl]-(2,6-difluorophenyl)methanone |
| SMILES | CN(C)c1ccc(Nc2nc(N)n(C(=O)c3c(F)cccc3F)n2)cc1 |
| InChI | InChI=1S/C17H16F2N6O/c1-24(2)11-8-6-10(7-9-11)21-17-22-16(20)25(23-17)15(26)14-12(18)4-3-5-13(14)19/h3-9H,1-2H3,(H3,20,21,22,23) |
| InChIKey | ZGFGFQUPXGGIOJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|