About 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione
5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 52948584) has the molecular formula C18H15Cl2N3O2
and a molecular weight of 376.24 g/mol. Its IUPAC name is 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione |
| PubChem CID | 52948584 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(Cl)cc2Cl)cc1NCc1ccccc1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c19-14-7-6-13(15(20)8-14)10-23-11-16(17(24)22-18(23)25)21-9-12-4-2-1-3-5-12/h1-8,11,21H,9-10H2,(H,22,24,25) |
| InChIKey | MCIRGCSQLYHOMS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione?
The IUPAC name of 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione (CID 52948584) is 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione?
The canonical SMILES for 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione is O=c1[nH]c(=O)n(Cc2ccc(Cl)cc2Cl)cc1NCc1ccccc1.
What is the InChIKey of 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione?
The InChIKey is MCIRGCSQLYHOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Cl2N3O2/c19-14-7-6-13(15(20)8-14)10-23-11-16(17(24)22-18(23)25)21-9-12-4-2-1-3-5-12/h1-8,11,21H,9-10H2,(H,22,24,25).
What are the key properties of 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione?
5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione has a molecular weight of 376.24 g/mol, XLogP of 3.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzylamino)-1-[(2,4-dichlorophenyl)methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 52948584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).