About 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine
6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine (PubChem CID 52948700) has the molecular formula C11H7F3N4S
and a molecular weight of 284.27 g/mol. Its IUPAC name is 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine |
| PubChem CID | 52948700 |
| Molecular Formula | C11H7F3N4S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Nc1[nH]nc2nc(-c3cccs3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C11H7F3N4S/c12-11(13,14)5-4-6(7-2-1-3-19-7)16-10-8(5)9(15)17-18-10/h1-4H,(H3,15,16,17,18) |
| InChIKey | YUHMIICGWLXAAD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine?
The IUPAC name of 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine (CID 52948700) is 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine.
What is the SMILES notation for 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine?
The canonical SMILES for 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine is Nc1[nH]nc2nc(-c3cccs3)cc(C(F)(F)F)c12.
What is the InChIKey of 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine?
The InChIKey is YUHMIICGWLXAAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F3N4S/c12-11(13,14)5-4-6(7-2-1-3-19-7)16-10-8(5)9(15)17-18-10/h1-4H,(H3,15,16,17,18).
What are the key properties of 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine?
6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine has a molecular weight of 284.27 g/mol, XLogP of 3.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-2-yl-4-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine is sourced from PubChem (CID 52948700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).