C26H24F3N3O2 — CID 52948835
1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyridin-2-one (PubChem CID 52948835) has the molecular formula C26H24F3N3O2 and a molecular weight of 467.49 g/mol. Its IUPAC name is 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyridin-2-one.
| Compound Name | 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 52948835 |
| Molecular Formula | C26H24F3N3O2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyridin-2-one |
| SMILES | CN1CCc2c(n(C)c3cc(-n4ccc(OCc5ccc(C(F)(F)F)cc5)cc4=O)ccc23)C1 |
| InChI | InChI=1S/C26H24F3N3O2/c1-30-11-10-22-21-8-7-19(13-23(21)31(2)24(22)15-30)32-12-9-20(14-25(32)33)34-16-17-3-5-18(6-4-17)26(27,28)29/h3-9,12-14H,10-11,15-16H2,1-2H3 |
| InChIKey | YUDSZRPQLYTMFK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 39.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|