C20H25BrO3 — CID 52948844
(1R,4aS,10aR)-6-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 52948844) has the molecular formula C20H25BrO3 and a molecular weight of 393.32 g/mol. Its IUPAC name is (1R,4aS,10aR)-6-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-6-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 52948844 |
| Molecular Formula | C20H25BrO3 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (1R,4aS,10aR)-6-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1Br)[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1CC2=O |
| InChI | InChI=1S/C20H25BrO3/c1-11(2)12-8-13-14(9-15(12)21)19(3)6-5-7-20(4,18(23)24)17(19)10-16(13)22/h8-9,11,17H,5-7,10H2,1-4H3,(H,23,24)/t17-,19-,20-/m1/s1 |
| InChIKey | RJZPGCJEDRDYHU-MISYRCLQSA-N |
| XLogP | 5.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |