About N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride
N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride (PubChem CID 52948851) has the molecular formula C14H24ClN3O
and a molecular weight of 285.82 g/mol. Its IUPAC name is N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride |
| PubChem CID | 52948851 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride |
| SMILES | CCN(CC)c1cncc(OC[C@@H]2CCCN2)c1.Cl |
| InChI | InChI=1S/C14H23N3O.ClH/c1-3-17(4-2)13-8-14(10-15-9-13)18-11-12-6-5-7-16-12;/h8-10,12,16H,3-7,11H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | VEWGQBAJSVYKCZ-YDALLXLXSA-N |
| XLogP | 2.48 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride?
The IUPAC name of N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride (CID 52948851) is N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride.
What is the SMILES notation for N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride?
The canonical SMILES for N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride is CCN(CC)c1cncc(OC[C@@H]2CCCN2)c1.Cl.
What is the InChIKey of N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride?
The InChIKey is VEWGQBAJSVYKCZ-YDALLXLXSA-N. The full InChI is InChI=1S/C14H23N3O.ClH/c1-3-17(4-2)13-8-14(10-15-9-13)18-11-12-6-5-7-16-12;/h8-10,12,16H,3-7,11H2,1-2H3;1H/t12-;/m0./s1.
What are the key properties of N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride?
N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride has a molecular weight of 285.82 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridin-3-amine;hydrochloride is sourced from PubChem (CID 52948851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).