C12H20N2O2S — CID 52948852
1-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]sulfonylpiperazine (PubChem CID 52948852) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]sulfonylpiperazine.
| Compound Name | 1-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]sulfonylpiperazine |
|---|---|
| PubChem CID | 52948852 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]sulfonylpiperazine |
| SMILES | C=C/C=C(C)/C(=C\C)S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H20N2O2S/c1-4-6-11(3)12(5-2)17(15,16)14-9-7-13-8-10-14/h4-6,13H,1,7-10H2,2-3H3/b11-6+,12-5+ |
| InChIKey | WWWRTIBHTUOIFG-HFQMJBPSSA-N |
| XLogP | 1.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|