About benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride
benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride (PubChem CID 52948909) has the molecular formula C20H22Cl3NO2
and a molecular weight of 414.76 g/mol. Its IUPAC name is benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride |
| PubChem CID | 52948909 |
| Molecular Formula | C20H22Cl3NO2 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride |
| SMILES | CN1CCC(C(=O)OCc2ccccc2)(c2ccc(Cl)c(Cl)c2)CC1.Cl |
| InChI | InChI=1S/C20H21Cl2NO2.ClH/c1-23-11-9-20(10-12-23,16-7-8-17(21)18(22)13-16)19(24)25-14-15-5-3-2-4-6-15;/h2-8,13H,9-12,14H2,1H3;1H |
| InChIKey | JQCIVYLOBXKYHU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride?
The IUPAC name of benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride (CID 52948909) is benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride?
The canonical SMILES for benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride is CN1CCC(C(=O)OCc2ccccc2)(c2ccc(Cl)c(Cl)c2)CC1.Cl.
What is the InChIKey of benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride?
The InChIKey is JQCIVYLOBXKYHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2NO2.ClH/c1-23-11-9-20(10-12-23,16-7-8-17(21)18(22)13-16)19(24)25-14-15-5-3-2-4-6-15;/h2-8,13H,9-12,14H2,1H3;1H.
What are the key properties of benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride?
benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride has a molecular weight of 414.76 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(3,4-dichlorophenyl)-1-methylpiperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 52948909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).