About bis(3-bromo-4,5-dihydroxyphenyl)methanone
bis(3-bromo-4,5-dihydroxyphenyl)methanone (PubChem CID 52948935) has the molecular formula C13H8Br2O5
and a molecular weight of 404.01 g/mol. Its IUPAC name is bis(3-bromo-4,5-dihydroxyphenyl)methanone.
Molecular Properties
| Compound Name | bis(3-bromo-4,5-dihydroxyphenyl)methanone |
| PubChem CID | 52948935 |
| Molecular Formula | C13H8Br2O5 |
| Molecular Weight | 404.01 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | bis(3-bromo-4,5-dihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(Br)c1)c1cc(O)c(O)c(Br)c1 |
| InChI | InChI=1S/C13H8Br2O5/c14-7-1-5(3-9(16)12(7)19)11(18)6-2-8(15)13(20)10(17)4-6/h1-4,16-17,19-20H |
| InChIKey | QWGGKBRLOGNRAY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.01 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze bis(3-bromo-4,5-dihydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-bromo-4,5-dihydroxyphenyl)methanone?
The IUPAC name of bis(3-bromo-4,5-dihydroxyphenyl)methanone (CID 52948935) is bis(3-bromo-4,5-dihydroxyphenyl)methanone.
What is the SMILES notation for bis(3-bromo-4,5-dihydroxyphenyl)methanone?
The canonical SMILES for bis(3-bromo-4,5-dihydroxyphenyl)methanone is O=C(c1cc(O)c(O)c(Br)c1)c1cc(O)c(O)c(Br)c1.
What is the InChIKey of bis(3-bromo-4,5-dihydroxyphenyl)methanone?
The InChIKey is QWGGKBRLOGNRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br2O5/c14-7-1-5(3-9(16)12(7)19)11(18)6-2-8(15)13(20)10(17)4-6/h1-4,16-17,19-20H.
What are the key properties of bis(3-bromo-4,5-dihydroxyphenyl)methanone?
bis(3-bromo-4,5-dihydroxyphenyl)methanone has a molecular weight of 404.01 g/mol, XLogP of 3.27, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-bromo-4,5-dihydroxyphenyl)methanone is sourced from PubChem (CID 52948935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).