C17H16FN3O3 — CID 52948947
(2S,3R,4R,5R)-5-fluoro-2-(4-naphthalen-2-yltriazol-1-yl)oxane-3,4-diol (PubChem CID 52948947) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-fluoro-2-(4-naphthalen-2-yltriazol-1-yl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-5-fluoro-2-(4-naphthalen-2-yltriazol-1-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 52948947 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (2S,3R,4R,5R)-5-fluoro-2-(4-naphthalen-2-yltriazol-1-yl)oxane-3,4-diol |
| SMILES | OC1[C@H](F)CO[C@H](n2cc(-c3ccc4ccccc4c3)nn2)[C@@H]1O |
| InChI | InChI=1S/C17H16FN3O3/c18-13-9-24-17(16(23)15(13)22)21-8-14(19-20-21)12-6-5-10-3-1-2-4-11(10)7-12/h1-8,13,15-17,22-23H,9H2/t13-,15?,16-,17+/m1/s1 |
| InChIKey | HBBQJXGIDIRHBU-HZTRTUMWSA-N |
| XLogP | 1.69 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |