C17H15F6N3O3S — CID 52948994
2-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]benzoic acid (PubChem CID 52948994) has the molecular formula C17H15F6N3O3S and a molecular weight of 455.38 g/mol. Its IUPAC name is 2-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 52948994 |
| Molecular Formula | C17H15F6N3O3S |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1N1CCN(c2ncc(C(O)(C(F)(F)F)C(F)(F)F)s2)CC1 |
| InChI | InChI=1S/C17H15F6N3O3S/c18-16(19,20)15(29,17(21,22)23)12-9-24-14(30-12)26-7-5-25(6-8-26)11-4-2-1-3-10(11)13(27)28/h1-4,9,29H,5-8H2,(H,27,28) |
| InChIKey | YUYVUYQOYLTECB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |