C18H23ClN2O2S — CID 52949040
3-(2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine;hydrochloride (PubChem CID 52949040) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is 3-(2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine;hydrochloride.
| Compound Name | 3-(2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 52949040 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-(2,2-dioxo-1-phenyl-3,4-dihydro-2λ6,1-benzothiazin-3-yl)-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCCC1Cc2ccccc2N(c2ccccc2)S1(=O)=O.Cl |
| InChI | InChI=1S/C18H22N2O2S.ClH/c1-19-13-7-11-17-14-15-8-5-6-12-18(15)20(23(17,21)22)16-9-3-2-4-10-16;/h2-6,8-10,12,17,19H,7,11,13-14H2,1H3;1H |
| InChIKey | TWOLHZITFDHKDN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|