C21H24N4O2 — CID 52949047
N-[(1-acetyl-2H-indol-3-ylidene)amino]-2-(2,6-dimethylanilino)propanamide (PubChem CID 52949047) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[(1-acetyl-2H-indol-3-ylidene)amino]-2-(2,6-dimethylanilino)propanamide.
| Compound Name | N-[(1-acetyl-2H-indol-3-ylidene)amino]-2-(2,6-dimethylanilino)propanamide |
|---|---|
| PubChem CID | 52949047 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-[(1-acetyl-2H-indol-3-ylidene)amino]-2-(2,6-dimethylanilino)propanamide |
| SMILES | CC(=O)N1CC(=NNC(=O)C(C)Nc2c(C)cccc2C)c2ccccc21 |
| InChI | InChI=1S/C21H24N4O2/c1-13-8-7-9-14(2)20(13)22-15(3)21(27)24-23-18-12-25(16(4)26)19-11-6-5-10-17(18)19/h5-11,15,22H,12H2,1-4H3,(H,24,27) |
| InChIKey | LJVBZYDJKQFPJG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|