About 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride
3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride (PubChem CID 52949231) has the molecular formula C21H19ClN2O4
and a molecular weight of 398.85 g/mol. Its IUPAC name is 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride.
Molecular Properties
| Compound Name | 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride |
| PubChem CID | 52949231 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride |
| SMILES | Cl.NCC(=O)OCCCn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H18N2O4.ClH/c22-12-17(24)27-11-5-10-23-19-14-7-2-3-8-15(14)20(25)18(19)13-6-1-4-9-16(13)21(23)26;/h1-4,6-9H,5,10-12,22H2;1H |
| InChIKey | IQKAOODLNIRKGO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride?
The IUPAC name of 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride (CID 52949231) is 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride.
What is the SMILES notation for 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride?
The canonical SMILES for 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride is Cl.NCC(=O)OCCCn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2.
What is the InChIKey of 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride?
The InChIKey is IQKAOODLNIRKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4.ClH/c22-12-17(24)27-11-5-10-23-19-14-7-2-3-8-15(14)20(25)18(19)13-6-1-4-9-16(13)21(23)26;/h1-4,6-9H,5,10-12,22H2;1H.
What are the key properties of 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride?
3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride has a molecular weight of 398.85 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propyl 2-aminoacetate;hydrochloride is sourced from PubChem (CID 52949231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).