About N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide
N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide (PubChem CID 52949384) has the molecular formula C19H15F3N2O3
and a molecular weight of 376.33 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide |
| PubChem CID | 52949384 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cnc(-c3ccc(OC(F)(F)F)cc3)o2)c1 |
| InChI | InChI=1S/C19H15F3N2O3/c1-11-7-12(2)9-14(8-11)24-17(25)16-10-23-18(26-16)13-3-5-15(6-4-13)27-19(20,21)22/h3-10H,1-2H3,(H,24,25) |
| InChIKey | YXVUTFYHKBJJGL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide?
The IUPAC name of N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide (CID 52949384) is N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide is Cc1cc(C)cc(NC(=O)c2cnc(-c3ccc(OC(F)(F)F)cc3)o2)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide?
The InChIKey is YXVUTFYHKBJJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N2O3/c1-11-7-12(2)9-14(8-11)24-17(25)16-10-23-18(26-16)13-3-5-15(6-4-13)27-19(20,21)22/h3-10H,1-2H3,(H,24,25).
What are the key properties of N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide?
N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide has a molecular weight of 376.33 g/mol, XLogP of 5.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 52949384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).