About 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide
3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide (PubChem CID 52949439) has the molecular formula C20H24N2O3
and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide.
Molecular Properties
| Compound Name | 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide |
| PubChem CID | 52949439 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide |
| SMILES | Cc1ccc(CN2[C@@H]3CC[C@H]2CC(Oc2cccc(C(N)=O)c2)C3)o1 |
| InChI | InChI=1S/C20H24N2O3/c1-13-5-8-18(24-13)12-22-15-6-7-16(22)11-19(10-15)25-17-4-2-3-14(9-17)20(21)23/h2-5,8-9,15-16,19H,6-7,10-12H2,1H3,(H2,21,23)/t15-,16+,19? |
| InChIKey | RMNBHDPKKIBKOP-MCPYQZEQSA-N |
| XLogP | 3.26 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide?
The IUPAC name of 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide (CID 52949439) is 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide.
What is the SMILES notation for 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide?
The canonical SMILES for 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide is Cc1ccc(CN2[C@@H]3CC[C@H]2CC(Oc2cccc(C(N)=O)c2)C3)o1.
What is the InChIKey of 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide?
The InChIKey is RMNBHDPKKIBKOP-MCPYQZEQSA-N. The full InChI is InChI=1S/C20H24N2O3/c1-13-5-8-18(24-13)12-22-15-6-7-16(22)11-19(10-15)25-17-4-2-3-14(9-17)20(21)23/h2-5,8-9,15-16,19H,6-7,10-12H2,1H3,(H2,21,23)/t15-,16+,19?.
What are the key properties of 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide?
3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide has a molecular weight of 340.42 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,5R)-8-[(5-methylfuran-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide is sourced from PubChem (CID 52949439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).