C21H17N3O2 — CID 52949455
4-[3-[2-(aminomethyl)phenyl]phenyl]-1-hydroxy-1,8-naphthyridin-2-one (PubChem CID 52949455) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-[3-[2-(aminomethyl)phenyl]phenyl]-1-hydroxy-1,8-naphthyridin-2-one.
| Compound Name | 4-[3-[2-(aminomethyl)phenyl]phenyl]-1-hydroxy-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 52949455 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[3-[2-(aminomethyl)phenyl]phenyl]-1-hydroxy-1,8-naphthyridin-2-one |
| SMILES | NCc1ccccc1-c1cccc(-c2cc(=O)n(O)c3ncccc23)c1 |
| InChI | InChI=1S/C21H17N3O2/c22-13-16-5-1-2-8-17(16)14-6-3-7-15(11-14)19-12-20(25)24(26)21-18(19)9-4-10-23-21/h1-12,26H,13,22H2 |
| InChIKey | XNCQHZOIZVMEPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|