About 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol
2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol (PubChem CID 52949555) has the molecular formula C19H17Cl2N5O3
and a molecular weight of 434.28 g/mol. Its IUPAC name is 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol |
| PubChem CID | 52949555 |
| Molecular Formula | C19H17Cl2N5O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol |
| SMILES | O=[N+]([O-])c1cnc(NC(CO)Cc2ccccc2)nc1Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N5O3/c20-15-7-6-13(9-16(15)21)23-18-17(26(28)29)10-22-19(25-18)24-14(11-27)8-12-4-2-1-3-5-12/h1-7,9-10,14,27H,8,11H2,(H2,22,23,24,25) |
| InChIKey | HRBBCJQKUAHSIT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol?
The IUPAC name of 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol (CID 52949555) is 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol.
What is the SMILES notation for 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol?
The canonical SMILES for 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol is O=[N+]([O-])c1cnc(NC(CO)Cc2ccccc2)nc1Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol?
The InChIKey is HRBBCJQKUAHSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2N5O3/c20-15-7-6-13(9-16(15)21)23-18-17(26(28)29)10-22-19(25-18)24-14(11-27)8-12-4-2-1-3-5-12/h1-7,9-10,14,27H,8,11H2,(H2,22,23,24,25).
What are the key properties of 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol?
2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol has a molecular weight of 434.28 g/mol, XLogP of 4.45, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3,4-dichloroanilino)-5-nitropyrimidin-2-yl]amino]-3-phenylpropan-1-ol is sourced from PubChem (CID 52949555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).