C35H48N4O5 — CID 52949576
N-[2-[7-[[(2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperazin-2-yl]methoxy]-3,4,4a,8a-tetrahydro-2H-quinolin-1-yl]ethyl]acetamide (PubChem CID 52949576) has the molecular formula C35H48N4O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is N-[2-[7-[[(2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperazin-2-yl]methoxy]-3,4,4a,8a-tetrahydro-2H-quinolin-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[7-[[(2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperazin-2-yl]methoxy]-3,4,4a,8a-tetrahydro-2H-quinolin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 52949576 |
| Molecular Formula | C35H48N4O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | N-[2-[7-[[(2R)-1-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperazin-2-yl]methoxy]-3,4,4a,8a-tetrahydro-2H-quinolin-1-yl]ethyl]acetamide |
| SMILES | COc1ccccc1COCCCOc1ccc(N2CCNC[C@@H]2COC2=CC3C(C=C2)CCCN3CCNC(C)=O)cc1 |
| InChI | InChI=1S/C35H48N4O5/c1-27(40)37-17-19-38-18-5-8-28-10-13-33(23-34(28)38)44-26-31-24-36-16-20-39(31)30-11-14-32(15-12-30)43-22-6-21-42-25-29-7-3-4-9-35(29)41-2/h3-4,7,9-15,23,28,31,34,36H,5-6,8,16-22,24-26H2,1-2H3,(H,37,40)/t28?,31-,34?/m1/s1 |
| InChIKey | HRBKKSHDZGRQIV-IEPGKUISSA-N |
| XLogP | 4.15 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|