About tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate
tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate (PubChem CID 52949729) has the molecular formula C23H23N3O4S
and a molecular weight of 437.52 g/mol. Its IUPAC name is tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate |
| PubChem CID | 52949729 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)c2cnccc2n3C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-15-5-8-17(9-6-15)31(28,29)25-16-7-10-20-18(13-16)19-14-24-12-11-21(19)26(20)22(27)30-23(2,3)4/h5-14,25H,1-4H3 |
| InChIKey | NYSLZWFXKUPUMN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate?
The IUPAC name of tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate (CID 52949729) is tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate.
What is the SMILES notation for tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate?
The canonical SMILES for tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate is Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)c2cnccc2n3C(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate?
The InChIKey is NYSLZWFXKUPUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O4S/c1-15-5-8-17(9-6-15)31(28,29)25-16-7-10-20-18(13-16)19-14-24-12-11-21(19)26(20)22(27)30-23(2,3)4/h5-14,25H,1-4H3.
What are the key properties of tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate?
tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate has a molecular weight of 437.52 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 8-[(4-methylphenyl)sulfonylamino]pyrido[4,3-b]indole-5-carboxylate is sourced from PubChem (CID 52949729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).