About 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one
2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one (PubChem CID 52949761) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one |
| PubChem CID | 52949761 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one |
| SMILES | CC(Nc1nc2cc[nH]c(=O)c2cc1-c1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C19H22N4O/c1-12(19(2,3)4)22-17-13(15-7-5-6-9-20-15)11-14-16(23-17)8-10-21-18(14)24/h5-12H,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | CTIOFGTUACTKHE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one?
The IUPAC name of 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one (CID 52949761) is 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one.
What is the SMILES notation for 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one?
The canonical SMILES for 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one is CC(Nc1nc2cc[nH]c(=O)c2cc1-c1ccccn1)C(C)(C)C.
What is the InChIKey of 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one?
The InChIKey is CTIOFGTUACTKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O/c1-12(19(2,3)4)22-17-13(15-7-5-6-9-20-15)11-14-16(23-17)8-10-21-18(14)24/h5-12H,1-4H3,(H,21,24)(H,22,23).
What are the key properties of 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one?
2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one has a molecular weight of 322.41 g/mol, XLogP of 3.83, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbutan-2-ylamino)-3-pyridin-2-yl-6H-1,6-naphthyridin-5-one is sourced from PubChem (CID 52949761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).