C15H24N2OS — CID 52949835
2-(3-piperidin-1-ylpropoxy)-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 52949835) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-(3-piperidin-1-ylpropoxy)-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-(3-piperidin-1-ylpropoxy)-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 52949835 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(3-piperidin-1-ylpropoxy)-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | C1CCN(CCCOc2nc3c(s2)CCCC3)CC1 |
| InChI | InChI=1S/C15H24N2OS/c1-4-9-17(10-5-1)11-6-12-18-15-16-13-7-2-3-8-14(13)19-15/h1-12H2 |
| InChIKey | CWFUYQIOUPGTKY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|