C22H19FN4O3S — CID 52949905
N-[3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-pyridin-2-ylamino]propyl]-4-fluorobenzamide (PubChem CID 52949905) has the molecular formula C22H19FN4O3S and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-pyridin-2-ylamino]propyl]-4-fluorobenzamide.
| Compound Name | N-[3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-pyridin-2-ylamino]propyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 52949905 |
| Molecular Formula | C22H19FN4O3S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-pyridin-2-ylamino]propyl]-4-fluorobenzamide |
| SMILES | O=C(NCCCN(C1=NS(=O)(=O)c2ccccc21)c1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19FN4O3S/c23-17-11-9-16(10-12-17)22(28)25-14-5-15-27(20-8-3-4-13-24-20)21-18-6-1-2-7-19(18)31(29,30)26-21/h1-4,6-13H,5,14-15H2,(H,25,28) |
| InChIKey | PEADHCKFIGCGNC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|