C17H18Cl2O6S — CID 52950124
(2S,3R,4S,5S,6R)-2-[3-chloro-2-[(5-chlorothiophen-2-yl)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 52950124) has the molecular formula C17H18Cl2O6S and a molecular weight of 421.30 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-chloro-2-[(5-chlorothiophen-2-yl)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-chloro-2-[(5-chlorothiophen-2-yl)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 52950124 |
| Molecular Formula | C17H18Cl2O6S |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-chloro-2-[(5-chlorothiophen-2-yl)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc(Cl)c2Cc2ccc(Cl)s2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H18Cl2O6S/c18-10-2-1-3-11(9(10)6-8-4-5-13(19)26-8)24-17-16(23)15(22)14(21)12(7-20)25-17/h1-5,12,14-17,20-23H,6-7H2/t12-,14-,15+,16-,17-/m1/s1 |
| InChIKey | ATLQGVKOISZQKP-USACIQFYSA-N |
| XLogP | 1.82 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |