C20H17N5O2 — CID 52950146
1-[4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-phenylurea (PubChem CID 52950146) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-[4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-phenylurea.
| Compound Name | 1-[4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 52950146 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-[4-(5-methylpyrrolo[3,2-d]pyrimidin-4-yl)oxyphenyl]-3-phenylurea |
| SMILES | Cn1ccc2ncnc(Oc3ccc(NC(=O)Nc4ccccc4)cc3)c21 |
| InChI | InChI=1S/C20H17N5O2/c1-25-12-11-17-18(25)19(22-13-21-17)27-16-9-7-15(8-10-16)24-20(26)23-14-5-3-2-4-6-14/h2-13H,1H3,(H2,23,24,26) |
| InChIKey | BVFBTDPKGZCIBA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |