C30H38F3N3O3 — CID 52950180
N-[2-[[(3S,4S)-4-butoxy-1-(4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 52950180) has the molecular formula C30H38F3N3O3 and a molecular weight of 545.65 g/mol. Its IUPAC name is N-[2-[[(3S,4S)-4-butoxy-1-(4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(3S,4S)-4-butoxy-1-(4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 52950180 |
| Molecular Formula | C30H38F3N3O3 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | N-[2-[[(3S,4S)-4-butoxy-1-(4-phenylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCCCO[C@H]1CN(C2CCC(c3ccccc3)CC2)C[C@@H]1NC(=O)CNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H38F3N3O3/c1-2-3-16-39-27-20-36(25-14-12-22(13-15-25)21-8-5-4-6-9-21)19-26(27)35-28(37)18-34-29(38)23-10-7-11-24(17-23)30(31,32)33/h4-11,17,22,25-27H,2-3,12-16,18-20H2,1H3,(H,34,38)(H,35,37)/t22?,25?,26-,27-/m0/s1 |
| InChIKey | WSILZVNXWWOLEZ-PLLYQWAOSA-N |
| XLogP | 5.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|