About hept-4-en-2-yl butanoate
hept-4-en-2-yl butanoate (PubChem CID 529502) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is hept-4-en-2-yl butanoate.
Molecular Properties
| Compound Name | hept-4-en-2-yl butanoate |
| PubChem CID | 529502 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | hept-4-en-2-yl butanoate |
| SMILES | CCC=CCC(C)OC(=O)CCC |
| InChI | InChI=1S/C11H20O2/c1-4-6-7-9-10(3)13-11(12)8-5-2/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | WIBPCRFLIFYVAN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-4-en-2-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-4-en-2-yl butanoate?
The IUPAC name of hept-4-en-2-yl butanoate (CID 529502) is hept-4-en-2-yl butanoate.
What is the SMILES notation for hept-4-en-2-yl butanoate?
The canonical SMILES for hept-4-en-2-yl butanoate is CCC=CCC(C)OC(=O)CCC.
What is the InChIKey of hept-4-en-2-yl butanoate?
The InChIKey is WIBPCRFLIFYVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-6-7-9-10(3)13-11(12)8-5-2/h6-7,10H,4-5,8-9H2,1-3H3.
What are the key properties of hept-4-en-2-yl butanoate?
hept-4-en-2-yl butanoate has a molecular weight of 184.28 g/mol, XLogP of 3.07, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-4-en-2-yl butanoate is sourced from PubChem (CID 529502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).