C15H12FNOS — CID 52950326
2-(2,4-dimethylphenyl)-5-fluoro-1,2-benzothiazol-3-one (PubChem CID 52950326) has the molecular formula C15H12FNOS and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-5-fluoro-1,2-benzothiazol-3-one.
| Compound Name | 2-(2,4-dimethylphenyl)-5-fluoro-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 52950326 |
| Molecular Formula | C15H12FNOS |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-5-fluoro-1,2-benzothiazol-3-one |
| SMILES | Cc1ccc(-n2sc3ccc(F)cc3c2=O)c(C)c1 |
| InChI | InChI=1S/C15H12FNOS/c1-9-3-5-13(10(2)7-9)17-15(18)12-8-11(16)4-6-14(12)19-17/h3-8H,1-2H3 |
| InChIKey | SPDLTCATSJANKS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |