C19H25N3O2 — CID 52950440
6-[(E)-3-oxo-3-(4-propylpiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 52950440) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-(4-propylpiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-oxo-3-(4-propylpiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 52950440 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 6-[(E)-3-oxo-3-(4-propylpiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | CCCC1CCN(C(=O)/C=C/c2cnc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-2-3-14-8-10-22(11-9-14)18(24)7-4-15-12-16-5-6-17(23)21-19(16)20-13-15/h4,7,12-14H,2-3,5-6,8-11H2,1H3,(H,20,21,23)/b7-4+ |
| InChIKey | SNXFJGDLNWCNJI-QPJJXVBHSA-N |
| XLogP | 3.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|